Sachaconitine

Catalog Number	ACM1361020-1
CAS Number	1361-02-0
Structure
Synonyms	(16S)-20-Ethyl-1alpha,16-dimethoxy-4-methylaconitane-8,14alpha-diol
IUPAC Name	11-Ethyl-6,16-dimethoxy-13-methyl-11-azahexacyclo[7.7.2.12,5.01,10.03,8.013,17]nonadecane-4,8-diol
Molecular Weight	391.54
Molecular Formula	C23H37NO4
Canonical SMILES	CCN1CC2(CCC(C34C2CC(C31)C5(CC(C6CC4C5C6O)OC)O)OC)C
InChI	InChI=1S/C23H37NO4/c1-5-24-11-21(2)7-6-17(28-4)23-13-8-12-15(27-3)10-22(26,18(13)19(12)25)14(20(23)24)9-16(21)23/h12-20,25-26H,5-11H2,1-4H3
InChI Key	NGWMZXLZSGJSRI-UHFFFAOYSA-N
Purity	98%+
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	688
Exact Mass	391.27225866
Heavy Atom Count	28
Monoisotopic Mass	391.27225866
Topological Polar Surface Area	62.2Ų

Custom Q&A

What is the chemical structure of Sachaconitine?

The chemical structure of Sachaconitine is (16S)-20-Ethyl-1α,16-dimethoxy-4-methylaconitane-8,14α-diol.

What are some synonyms for Sachaconitine?

Some synonyms for Sachaconitine include Vilmorrianine D.

In which plant can Sachaconitine be found?

Sachaconitine occurs in the roots of Aconitum miyabei Nakai.

How does Sachaconitine crystallize?

Sachaconitine crystallizes as colorless needles from EtOH.

What is the specific rotation of Sachaconitine in 95% EtOH?

The specific rotation of Sachaconitine in 95% EtOH is [α]D20 -13.1° (c 2.35).

What is the molecular formula of Sachaconitine?

The molecular formula of Sachaconitine is C23H37NO4.

What is the molecular weight of Sachaconitine?

The molecular weight of Sachaconitine is 391.548 g/mol.

What is the CAS number for Sachaconitine?

The CAS number for Sachaconitine is 1361-02-0.

What is another name for Sachaconitine?

Another name for Sachaconitine is (16S)-20-Ethyl-1α,16-dimethoxy-4-methylaconitane-8,14α-diol.

How is Sachaconitine used in synthesis?

Sachaconitine can be used in synthesis to produce various compounds or as a reference compound for analytical purposes.

※ Please kindly note that our products are for research use only.