Sarpagine

Catalog Number	ACM482688-1
CAS Number	482-68-8
Description	Sarpagine is a biomimetic molecule that is structurally similar to the natural steroidal alkaloids found in plants of the Apocynaceae family. It was synthesized by asymmetric synthesis and its nmr spectra were investigated. The chemical reaction of Sarpagine with an hydroxyl group was studied. Sarpagine has been shown to have biological properties, such as antimicrobial and anti-inflammatory activities. This drug also has regulatory effects on the immune system, which may be due to its ability to inhibit the production of cytokines and inflammatory mediators.
Molecular Weight	310.40 g/mol
Canonical SMILES	C/C=C\1/CN2[C@H]3C[C@@H]1[C@H]([C@@H]2CC4=C3NC5=C4C=C(C=C5)O)CO
Storage	store at 2℃-8℃
Harmonized Tariff Code	Switzerland: 29333900 - USA: 2933396190 - Slovakia: 2933399990 - UK: 2933399990 - China: 2933399099
MDL Number	MFCD00189439

Custom Q&A

What is the molecular formula of SARPAGINE?

The molecular formula of SARPAGINE is C19H22N2O2.

What is the CAS number for SARPAGINE?

The CAS number for SARPAGINE is 482-68-8.

What is the melting point of SARPAGINE?

The melting point of SARPAGINE is 320°C.

In what solvents is SARPAGINE soluble?

SARPAGINE is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What is the refractive index of SARPAGINE?

The refractive index of SARPAGINE is 1.5600 (estimate).

What is the pka value of SARPAGINE?

The pka value of SARPAGINE is 10.24±0.40 (Predicted).

What is the boiling point of SARPAGINE?

The boiling point of SARPAGINE is estimated to be 450.55°C.

What is the HazardClass of SARPAGINE?

The HazardClass of SARPAGINE is 6.1(b).

What is the PackingGroup of SARPAGINE?

The PackingGroup of SARPAGINE is III.

Where can SARPAGINE be isolated from?

SARPAGINE can be isolated from Rauwolfia serpentina.

※ Please kindly note that our products are for research use only.