Seneciphylline N-oxide

Seneciphylline N-oxide

Inquiry
Catalog Number ACM38710268
CAS Number 38710-26-8
Structure
Description Seneciphylline N-oxide is a model system. It is a quinone that has been shown to be regulated in transcriptional regulation and protein synthesis. It has been used as a sample preparation for tissue culture studies and an analytical method for the detection of monoclonal antibodies. The matrix effect on protein synthesis has been studied under different conditions, including tissue culture and chemical interactions with the drug. The uptake of seneciphylline N-oxide was observed in plant families such as legumes and soybeans, which have polyclonal antibodies that are specific to this drug.
Molecular Weight 349.38 g/mol
Molecular Formula C18H23NO6
Canonical SMILES C/C=C/1\CC(=C)[C@@](C(=O)OCC2=CC[N+]3([C@H]2[C@@H](CC3)OC1=O)[O-])(C)O
Storage store at 2℃-8℃, close container well
Harmonized Tariff Code Switzerland: 29397900 - USA: 2939790000 - Slovakia: 2939799090 - UK: 2939799090 - China: 2939799099
Custom Q&A

What is the chemical formula for Seneciphylline N-oxide?

The chemical formula for Seneciphylline N-oxide is C18H23NO6.

What is the molecular weight of Seneciphylline N-oxide?

The molecular weight of Seneciphylline N-oxide is 349.38 g/mol.

What is the storage temperature recommended for Seneciphylline N-oxide?

The recommended storage temperature for Seneciphylline N-oxide is 2-8°C.

Where is Seneciphylline N-oxide naturally found?

Seneciphylline N-oxide is naturally found in the extracts of Adenostyles alliariae, a plant native to the western Alps.

What is the biological activity of Seneciphylline N-Oxide?

Seneciphylline N-Oxide is a dehydrogenation product of Senecionine N-oxide, isolated from root cultures of Senecio erucifolius.

What are the potential health effects of pyrrolizidine alkaloids like Seneciphylline N-oxide?

Pyrrolizidine alkaloids have adverse health effects and were classified as genotoxic, carcinogen, and hepatotoxic.

How is Seneciphylline N-oxide related to spartioidine?

Seneciphylline N-oxide derives from a spartioidine, which is a pyrrolizine alkaloid.

What is the role of Seneciphylline N-oxide as a Jacobaea metabolite?

Seneciphylline N-oxide has a role as a Jacobaea metabolite.

In what types of plants are pyrrolizidine alkaloids like Seneciphylline N-oxide commonly found?

Pyrrolizidine alkaloids are commonly found in plants from families such as Boraginaceae, Asteraceae, and Fabaceae.

Why is Seneciphylline N-oxide considered highly toxic to mammals and a suspected mutagen?

Seneciphylline N-oxide is considered highly toxic to mammals and a suspected mutagen due to its pyrrolizidine alkaloid nature and potential adverse health effects.

※ Please kindly note that our products are for research use only.