Sinoacutine

Catalog Number	ACM4090180-1
CAS Number	4090-18-0
Structure
Synonyms	(9α,13α)-5,6,8,14-Tetradehydro-4-hydroxy-3,6-dimethoxy-17-methylmorphinan-7-one
Molecular Weight	327.4
InChI	InChI=1S/C19H21NO4/c1-20-7-6-19-10-16(24-3)14(21)9-12(19)13(20)8-11-4-5-15(23-2)18(22)17(11)19/h4-5,9-10,13,22H,6-8H2,1-3H3/t13-,19+/m0/s1
InChI Key	GVTRUVGBZQJVTF-ORAYPTAESA-N
Melting Point	198 °C
Purity	95%+
Complexity	613
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	327.14705815
Heavy Atom Count	24
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	CN1CC[C@@]23C=C(C(=O)C=C2[C@@H]1CC4=C3C(=C(C=C4)OC)O)OC
Monoisotopic Mass	327.14705815
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	59 Ų

Custom Q&A

What is the chemical formula of SINOACUTINE?

The chemical formula of SINOACUTINE is C19H21NO4.

What is the molecular weight of SINOACUTINE?

The molecular weight of SINOACUTINE is 327.37.

What is the melting point of SINOACUTINE?

The melting point of SINOACUTINE is 198℃.

How soluble is SINOACUTINE in DMF?

SINOACUTINE is soluble in DMF at a concentration of 10mg/mL.

What is the predicted pka value of SINOACUTINE?

The predicted pka value of SINOACUTINE is 9.28±0.40.

What is the boiling point of SINOACUTINE?

The predicted boiling point of SINOACUTINE is 532.5±50.0 °C.

What is SINOACUTINE used for?

SINOACUTINE is used as a prolyl oligopeptidase inhibitor.

What are some synonyms for SINOACUTINE?

Some synonyms for SINOACUTINE include Siacutine, Salutarine, and L-Sinoacutine.

In what form does SINOACUTINE exist?

SINOACUTINE exists in the form of a solid.

What is the solubility of SINOACUTINE in ethanol?

SINOACUTINE is soluble in ethanol at a concentration of 1mg/mL.

※ Please kindly note that our products are for research use only.