Stachydrine

Catalog Number	ACM471874
CAS Number	471-87-4
Structure
Synonyms	Proline betaine
IUPAC Name	(2S)-1,1-Dimethylpyrrolidin-1-ium-2-carboxylate
Molecular Weight	143.18
Molecular Formula	C7H13NO2
Canonical SMILES	C[N+]1(CCCC1C(=O)[O-])C
InChI	InChI=1S/C7H13NO2/c1-8(2)5-3-4-6(8)7(9)10/h6H,3-5H2,1-2H3/t6-/m0/s1
InChI Key	CMUNUTVVOOHQPW-LURJTMIESA-N
Purity	98%+(HPLC)
Storage	Store at 4 °C, sealed, away from light (valid for 2 years under this condition).
Complexity	148
Exact Mass	143.094628657
Heavy Atom Count	10
Isomeric SMILES	C[N+]1(CCC[C@H]1C(=O)[O-])C
Monoisotopic Mass	143.094628657
Topological Polar Surface Area	40.1Ų

Custom Q&A

What is the chemical formula of Stachydrine?

The chemical formula of Stachydrine is C7H13NO3.

What is the molecular weight of Stachydrine?

The molecular weight of Stachydrine is 159.18302.

At what temperature does Stachydrine melt?

Stachydrine melts at a temperature of 259-260°C.

What is the specific rotation of Stachydrine in water?

The specific rotation of Stachydrine in water is +37.8°.

In which fruits can Stachydrine be found naturally?

Stachydrine occurs naturally in the fruit of Capparis torrnentosa, Citrus grandis, and Stachys tubi/era Naudin.

What is the solubility of Stachydrine in ethanol and water?

Stachydrine is soluble in ethanol and water, but insoluble in CHCl3 and Et2O.

What is the melting point of the hydrochloride form of Stachydrine?

The hydrochloride form of Stachydrine has a melting point of 222°C.

How is Stachydrine used in terms of promoting healthy neural development in unborn babies?

Stachydrine can be used to promote healthy neural development in unborn babies.

What is the role of Stachydrine in determining the effects of post-weaning diet and maternal obesity on mouse liver and brain metabolomes?

Stachydrine can be used to determine the differential effects of post-weaning diet and maternal obesity on mouse liver and brain metabolomes.

What is the chemical structure of Stachydrine?

Stachydrine is an amino-acid betaine that is a trans-4-hydroxy-D-proline zwitterion in which both of the hydrogens attached to the nitrogen have been replaced by methyl groups.

※ Please kindly note that our products are for research use only.