Stemonidine

Stemonidine

Inquiry
Catalog Number ACM85700476
CAS Number 85700-47-6
Molecular Weight 351.4
InChI InChI=1S/C19H29NO5/c1-11-9-14(24-17(11)21)13-6-7-15-19(10-12(2)18(22)25-19)16(23-3)5-4-8-20(13)15/h11-16H,4-10H2,1-3H3
InChI Key TZPKEJFBTXRNTK-UHFFFAOYSA-N
Melting Point 116 °C
Purity 90%+
Complexity 566
Covalently-Bonded Unit Count 1
Defined Atom Stereocenter Count 0
Exact Mass 351.20457303
Heavy Atom Count 25
Hydrogen Bond Acceptor Count 6
Hydrogen Bond Donor Count 0
Monoisotopic Mass 351.20457303
PhysicalState Powder
Rotatable Bond Count 2
Topological Polar Surface Area 65.1 Ų
Custom Q&A

What is the chemical formula of Stemonidine?

The chemical formula of Stemonidine is C19H29NO5.

What is the molecular weight of Stemonidine?

The molecular weight of Stemonidine is 351.44.

At what temperature does Stemonidine melt?

Stemonidine melts at 116°C.

What is the CAS number for Stemonidine?

The CAS number for Stemonidine is 85700-47-6.

From which plant is Stemonidine extracted?

Stemonidine is extracted from Stemona sessilifolia.

What activity does Stemonidine exhibit?

Stemonidine acts as an insecticidal and displays antitussive activity.

How is the alkaloid Stemonidine characterized?

Stemonidine is characterized as the hydrochloride which decomposes at 260°C and the methiodide, decomposing at 248°C.

How is Stemonidine affected by HCI in AcOH or EtOH?

Stemonidine is not affected by HCI in either AcOH or EtOH.

What are the two substances formed from Stemonidine when oxidized with KMnO4 in dilute H2SO4?

The two substances formed are a neutral compound, C16H23O5N, and a substance C11H17O4N.

What is the melting point of the methiodide obtained from the base formed during oxidation of Stemonidine in Me2CO?

The methiodide obtained from the base has a melting point of 235°C.

※ Please kindly note that our products are for research use only.