Trichostatin A

Trichostatin A

Inquiry
Catalog Number ACM58880196-1
CAS Number 58880-19-6
Structure
Synonyms TSA
IUPAC Name (2E,4E,6R)-7-[4-(Dimethylamino)phenyl]-N-hydroxy-4,6-dimethyl-7-oxohepta-2,4-dienamide
Molecular Weight 302.37
Molecular Formula C17H22N2O3
Canonical SMILES CC(C=C(C)C=CC(=O)NO)C(=O)C1=CC=C(C=C1)N(C)C
InChI InChI=1S/C17H22N2O3/c1-12(5-10-16(20)18-22)11-13(2)17(21)14-6-8-15(9-7-14)19(3)4/h5-11,13,22H,1-4H3,(H,18,20)/b10-5+,12-11+/t13-/m1/s1
InChI Key RTKIYFITIVXBLE-QEQCGCAPSA-N
Purity 98%+
Storage Store in dry, low temperature, sealed, 2-8 °C.
Complexity 447
Exact Mass 302.16304257
Heavy Atom Count 22
Isomeric SMILES C[C@H](/C=C(\C)/C=C/C(=O)NO)C(=O)C1=CC=C(C=C1)N(C)C
Monoisotopic Mass 302.16304257
Topological Polar Surface Area 69.6Ų
Custom Q&A

What is the chemical formula for Trichostatin A?

The chemical formula for Trichostatin A is C17H22N2O3.

What is the CAS number for Trichostatin A?

The CAS number for Trichostatin A is 58880-19-6.

What is the melting point of Trichostatin A?

The melting point of Trichostatin A is 140-143℃.

What is the stability of Trichostatin A?

Trichostatin A is stable for 2 years from the date of purchase as supplied.

How is Trichostatin A stored?

Trichostatin A is stored at -20°C.

What are the hazard codes associated with Trichostatin A?

The hazard codes for Trichostatin A are Xn and Xi.

What are the uses of Trichostatin A?

Trichostatin A is used as a known inhibitor of fibrosis, as an anticancer agent, and as a differentiation inducer of friend leukemic cells.

What is the biological activity of Trichostatin A?

Trichostatin A is a selective and potent inhibitor of histone deacetylase, with potential anti-cancer properties and the ability to induce accelerated dedifferentiation of cells.

How does Trichostatin A affect gene expression?

Trichostatin A inhibits histone deacetylase, leading to histone hyperacetylation, chromatin relaxation, and modulation of gene expression.

How is Trichostatin A used in research studies?

Trichostatin A is used as a histone deacetylase inhibitor in stem cell testing, in primary cell cultures to study insulin control of gene expression, and in HDAC inhibition experiments.

※ Please kindly note that our products are for research use only.