Trilobinine

Catalog Number	ACM126595924
CAS Number	126595-92-4
Molecular Weight	342.4
InChI	InChI=1S/C20H23NO4/c1-21(2)6-5-11-9-16(25-4)20(23)19-17(11)14(21)8-12-7-13(24-3)10-15(22)18(12)19/h7,9-10,14H,5-6,8H2,1-4H3,(H-,22,23)/p+1/t14-/m0/s1
InChI Key	VTQUMUPOLNPVHP-AWEZNQCLSA-O
Purity	95%+
Complexity	498
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	1
Exact Mass	342.17053325
Heavy Atom Count	25
Hydrogen Bond Acceptor Count	4
Hydrogen Bond Donor Count	2
Isomeric SMILES	C[N+]1(CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=CC(=C4)OC)O)O)OC)C
Monoisotopic Mass	342.17053325
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	58.9 Ų

Custom Q&A

What is the CAS number for trilobinine?

The CAS number for trilobinine is 126595-92-4.

What is the molecular formula of trilobinine?

The molecular formula of trilobinine is C20H24NO4+.

What is the molecular weight of trilobinine?

The molecular weight of trilobinine is 342.41.

Is trilobinine a natural or synthetic compound?

Trilobinine is likely a natural compound based on its name and structure.

What is the chemical structure of trilobinine?

The chemical structure of trilobinine contains 20 carbon atoms, 24 hydrogen atoms, and one nitrogen atom.

What is the potential use of trilobinine?

Trilobinine may have potential uses in medicine or pharmacology due to its chemical structure.

※ Please kindly note that our products are for research use only.