Tropanyl 3-hydroxy-4-methoxycinnamate

Catalog Number	ACM86702581
CAS Number	86702-58-1
Molecular Weight	317.4
InChI	InChI=1S/C18H23NO4/c1-19-13-5-6-14(19)11-15(10-13)23-18(21)8-4-12-3-7-16(20)17(9-12)22-2/h3-4,7-9,13-15,20H,5-6,10-11H2,1-2H3/b8-4+/t13-,14+,15
InChI Key	RSPBFOSKTPFBGJ-LYEGFCJJSA-N
Purity	95%+
Complexity	438
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	317.16270821
Heavy Atom Count	23
Hydrogen Bond Acceptor Count	5
Hydrogen Bond Donor Count	1
Isomeric SMILES	CN1[C@@H]2CC[C@H]1CC(C2)OC(=O)/C=C/C3=CC(=C(C=C3)O)OC
Monoisotopic Mass	317.16270821
PhysicalState	Powder
Rotatable Bond Count	5
Topological Polar Surface Area	59 Ų

Custom Q&A

What is the chemical formula for Tropanyl 3-hydroxy-4-methoxycinnamate?

The chemical formula is C18H23NO4.

What is the molecular weight of Tropanyl 3-hydroxy-4-methoxycinnamate?

The molecular weight is 317.38 g/mol.

What is the CAS number for Tropanyl 3-hydroxy-4-methoxycinnamate?

The CAS number is 86702-58-1.

What is the predicted boiling point of Tropanyl 3-hydroxy-4-methoxycinnamate?

The predicted boiling point is 453.5±45.0 °C.

In what forms is Tropanyl 3-hydroxy-4-methoxycinnamate soluble?

It is soluble in chloroform, dichloromethane, ethyl acetate, DMSO, acetone, etc.

What is the predicted pKa value of Tropanyl 3-hydroxy-4-methoxycinnamate?

The predicted pKa value is 9.72±0.31.

Can Tropanyl 3-hydroxy-4-methoxycinnamate exist in a powder form?

Yes, it can exist in a powder form.

What are some synonyms for Tropanyl 3-hydroxy-4-methoxycinnamate?

Some synonyms are 2-Propenoic acid, 3-(4-hydroxy-3-methoxyphenyl)-, (3-endo)-8-methyl-8-azabicyclo[3.2.1]oct-3-yl ester, and others.

What is the density of Tropanyl 3-hydroxy-4-methoxycinnamate?

The density is 1.23±0.1 g/cm3 predicted.

What are some common solvents in which Tropanyl 3-hydroxy-4-methoxycinnamate is soluble?

It is soluble in chloroform, dichloromethane, ethyl acetate, DMSO, acetone, etc.

※ Please kindly note that our products are for research use only.