Tryptamine

Catalog Number	ACM61541
CAS Number	61-54-1
Synonyms	(Amino-2 ethyl)-3 indole
IUPAC Name	2-(1H-Indol-3-yl)ethanamine
Molecular Weight	160.22
Molecular Formula	C10H12N2
Canonical SMILES	C1=CC=C2C(=C1)C(=CN2)CCN
InChI	InChI=1S/C10H12N2/c11-6-5-8-7-12-10-4-2-1-3-9(8)10/h1-4,7,12H,5-6,11H2
InChI Key	APJYDQYYACXCRM-UHFFFAOYSA-N
Boiling Point	137 °C/0.15 mmHg(lit.)
Melting Point	113-116 °C(lit.)
Flash Point	185 °C
Purity	99%
Density	0.9787 g/cm³
Appearance	White crystalline
Storage	2-8 °C
Complexity	147
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	0
Exact Mass	160.100048391
Heavy Atom Count	12
Hydrogen Bond Acceptor Count	1
Hydrogen Bond Donor Count	2
Monoisotopic Mass	160.100048391
PhysicalState	Powder
Rotatable Bond Count	2
Topological Polar Surface Area	41.8 Ų

Custom Q&A

What is the chemical formula for Tryptamine?

The chemical formula for Tryptamine is C10H12N2.

What is the melting point of Tryptamine?

The melting point of Tryptamine is 113-116 °C.

What is the main function of Tryptamine in the central nervous system?

Tryptamine acts as a modulator or neurotransmitter by releasing serotonin agents in the central nervous system.

How is Tryptamine synthesized?

Tryptamine is synthesized by the decarboxylation of the amino acid tryptophan.

What is the role of Tryptamine in plants?

In plants, Tryptamine acts as a promising phase to the plant hormone indole-3-acetic acid in one biosynthetic pathway.

What are some safety hazards associated with Tryptamine?

Tryptamine is considered an irritant and can cause risks related to skin and eye irritation.

What are some plants that contain Tryptamine?

Magic mushrooms are the most common fungi that contain Tryptamine derivatives.

What is the role of serotonin in relation to Tryptamine?

Serotonin, a natural derivative of Tryptamine, is a significant signaling hormone that helps in the modulation and regulation of processes within the central nervous system.

How is Tryptamine commonly used in the field of chemistry?

Tryptamine is commonly used in the preparation of biologically active compounds such as neurotransmitters and psychedelics.

What is the general description of Tryptamines?

Tryptamines are usually found in plants, fungi, animals, etc., and are categorized under the monoamine alkaloids class of compounds.

※ Please kindly note that our products are for research use only.