Venoterpine

Catalog Number	ACM17948424
CAS Number	17948-42-4
Structure
Synonyms	(6S,7R)-6,7-Dihydro-7-methyl-5H-cyclopenta[c]pyridin-6-ol
Molecular Weight	149.19
InChI	InChI=1S/C9H11NO/c1-6-8-5-10-3-2-7(8)4-9(6)11/h2-3,5-6,9,11H,4H2,1H3/t6-,9+/m0/s1
InChI Key	IOIGOIPHPUCFOB-IMTBSYHQSA-N
Melting Point	128-130 °C
Purity	95%+
Complexity	149
Covalently-Bonded Unit Count	1
Defined Atom Stereocenter Count	2
Exact Mass	149.084063974
Heavy Atom Count	11
Hydrogen Bond Acceptor Count	2
Hydrogen Bond Donor Count	1
Isomeric SMILES	C[C@@H]1[C@@H](CC2=C1C=NC=C2)O
Monoisotopic Mass	149.084063974
PhysicalState	Solid
Rotatable Bond Count	0
Topological Polar Surface Area	33.1 Ų

Custom Q&A

What is the chemical formula of Venoterpine?

The chemical formula of Venoterpine is C9H11NO.

What is the molecular weight of Venoterpine?

The molecular weight of Venoterpine is 149.19.

At what temperature does Venoterpine melt?

Venoterpine melts at a temperature of 128-130°C.

What is the predicted boiling point of Venoterpine?

The predicted boiling point of Venoterpine is 261.0±40.0 °C.

In which solvents is Venoterpine soluble?

Venoterpine is soluble in Chloroform, Dichloromethane, Ethyl Acetate, DMSO, Acetone, etc.

What form does Venoterpine come in?

Venoterpine comes in the form of oil.

In which plant is Venoterpine naturally occurring?

Venoterpine naturally occurs in Alstonia venenata.

What is the percentage of Venoterpine present in the fruit of Alstonia venenata?

Venoterpine is present in the fruit of Alstonia venenata to the extent of 0.0008 per cent.

How was the structure of Venoterpine determined?

The structure of Venoterpine was determined from ORO-CD data and comparison with L-( - )-Actinidine.

※ Please kindly note that our products are for research use only.