Vincristine sulfate

Catalog Number	ACM2068782-1
CAS Number	2068-78-2
Structure
Synonyms	Kyocristine
IUPAC Name	Methyl (1R,9R,10S,11R,12R,19R)-11-acetyloxy-12-ethyl-4-[(13S,15S,17S)-17-ethyl-17-hydroxy-13-methoxycarbonyl-1,11-diazatetracyclo[13.3.1.04,12.05,10]nonadeca-4(12),5,7,9-tetraen-13-yl]-8-formyl-10-hydroxy-5-methoxy-8,16-diazapentacyclo[10.6.1.01,9.02,7.016,19]nonadeca-2,4,6,13-tetraene-10-carboxylate;sulfuric acid
Molecular Weight	923.04
Molecular Formula	C46H58N4O14S
Canonical SMILES	CCC1(CC2CC(C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)C78CCN9C7C(C=CC9)(C(C(C8N6C=O)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O.OS(=O)(=O)O
InChI	InChI=1S/C46H56N4O10.H2O4S/c1-7-42(55)22-28-23-45(40(53)58-5,36-30(14-18-48(24-28)25-42)29-12-9-10-13-33(29)47-36)32-20-31-34(21-35(32)57-4)50(26-51)38-44(31)16-19-49-17-11-15-43(8-2,37(44)49)39(60-27(3)52)46(38,56)41(54)59-6;1-5(2,3)4/h9-13,15,20-21,26,28,37-39,47,55-56H,7-8,14,16-19,22-25H2,1-6H3;(H2,1,2,3,4)/t28-,37+,38-,39-,42+,43-,44-,45+,46+;/m1./s1
InChI Key	AQTQHPDCURKLKT-JKDPCDLQSA-N
Purity	98%+ (HPLC)
Storage	Store in dry, low temperature, sealed, 2-8 °C.
Complexity	1830
Exact Mass	922.36702371
Heavy Atom Count	65
Isomeric SMILES	CC[C@@]1(C[C@@H]2C[C@@](C3=C(CCN(C2)C1)C4=CC=CC=C4N3)(C5=C(C=C6C(=C5)[C@]78CCN9[C@H]7[C@@](C=CC9)([C@H]([C@@]([C@@H]8N6C=O)(C(=O)OC)O)OC(=O)C)CC)OC)C(=O)OC)O.OS(=O)(=O)O
Monoisotopic Mass	922.36702371
Topological Polar Surface Area	254Ų

Custom Q&A

What is the chemical formula of Vincristine sulfate?

The chemical formula of Vincristine sulfate is C46H58N4O14S.

What is the molecular weight of Vincristine sulfate?

The molecular weight of Vincristine sulfate is 923.04 g/mol.

What are some synonyms for Vincristine sulfate?

Some synonyms for Vincristine sulfate include Oncovin, Leurocristine, and Vinblastine.

How does Vincristine sulfate affect cell cycle progression?

Vincristine sulfate arrests the cell cycle at G2/M by interfering with mitotic spindle formation.

What is the therapeutic function of Vincristine sulfate?

Vincristine sulfate is used in cancer chemotherapy.

How is Vincristine sulfate typically administered in clinical settings?

Vincristine sulfate is available as a 1-mg/mL solution for IV administration.

How is Vincristine sulfate metabolized in the body?

Vincristine sulfate is metabolized in the liver by cytochrome P450 enzymes and excreted mainly in bile.

What are some potential drug interactions of Vincristine sulfate?

Potential drug interactions include increased risk of toxicity with cytotoxic drugs and altered levels of antiepileptic drugs.

What are some common toxicities associated with Vincristine sulfate?

Common toxicities include neurotoxicity, peripheral neuropathy, constipation, alopecia, and myelosuppression.

What is the mode of action of Vincristine sulfate on tumor cells?

Vincristine sulfate binds irreversibly to microtubules and interferes with the formation of the mitotic spindle, arresting tumor cells in metaphase.

※ Please kindly note that our products are for research use only.