Viqualine

Catalog Number	ACM72714740-1
CAS Number	72714-74-0
Structure
Description	Viqualine is a bicyclic heterocycle that has been shown to be an effective treatment for chronic schizophrenia and influenza virus. Viqualine can inhibit the uptake of adenosine, which is an endogenous nucleoside that acts as a neuromodulator in the brain. It also binds to 5-HT7 receptors and inhibits serotonin reuptake. These effects may contribute to its antidepressant properties. Viqualine has been shown to improve clinical response rates in patients with major depressive disorder (MDD). Viqualine also affects phosphodiesterase enzymes, which may help explain its pharmacological properties.
Molecular Weight	310.43 g/mol
Molecular Formula	C20H26N2O
Canonical SMILES	COC1=CC2=C(C=CN=C2C=C1)CCC[C@@H]3CCNC[C@@H]3C=C

Custom Q&A

What is the product name of this chemical compound?

The product name is Viqualine.

What are some of the synonyms for Viqualine?

Some synonyms for Viqualine include PK-5078 and 4-[3-[(3R,4R)-3-Ethenyl-4-piperidinyl]propyl]-6-methoxyquinoline.

What is the CAS number for Viqualine?

The CAS number for Viqualine is 72714-74-0.

What is the molecular formula for Viqualine?

The molecular formula for Viqualine is C20H26N2O.

What is the molecular weight of Viqualine?

The molecular weight of Viqualine is 310.43 g/mol.

What is the boiling point of Viqualine?

The boiling point of Viqualine is predicted to be 466.7±40.0 °C.

What is the density of Viqualine?

The density of Viqualine is predicted to be 1.072±0.06 g/cm3.

What is the pka value of Viqualine?

The pka value of Viqualine is predicted to be 10.25±0.10.

What is the chemical structure of Viqualine and how does it relate to its properties?

The chemical structure of Viqualine is 4-[3-(3-ethenylpiperidin-4-yl)propyl]-6-methoxyquinoline, and its properties such as boiling point, density, and pka value can be predicted based on this structure.

※ Please kindly note that our products are for research use only.